{"id":{"repo_id":"emich","oai_identifier":"oai:commons.emich.edu:theses-1042"},"canonical_url":"https://search.dev.ndltd.org/etd/emich/oai:commons.emich.edu:theses-1042","repository":{"repo_id":"emich","name":"Eastern Michigan University","base_url":"https://commons.emich.edu/do/oai/"},"display":{"title":"Kinetics of the ligand exchange reactions between bidentate ligands and rriethylenetetramine nickelate (II) and synthesis of boron (III) subphthalocyanines with various boron substitutions","abstract":"<p>Part 1. The kinetics of the ligand exchange reaction between 5-methyl-1,10-phenanthroline and triethylenetetramine nickel (II) were studied spectrophotometrically over the pH range of 5.2 to 8.0 at 25oC. A ternary complex Ni(Trien)(5MP) forms within a few seconds and subsequently reacts with 5MP to form Ni(5MP)3. The reaction is first-order with respect to: [5MP], [Ni(Trien)(5MP)] and [H+]. The rate law is given by:</p> <p>k dt d[Ni(trien)] = ( − MP Ni(trien)(5MP) + kH, 5MP Ni(trien)(5MP) [H+]) [Ni(trien)][5mp]</p> <p>where: 5MP is 5-methyl-1,10-phenanthroline and k is the first order rate constant that has units of 1/time.</p> <p>kH, 5mp Ni(trien)(5mp) = 9.78 X 104 M-2 s-1</p> <p>and k5mp Ni(trien)(5mp) = 9.42 X 10-3 M-2 s-1</p> <p>Part 2. Axial substitution on boron (III) subphthalocyanines (SubPcs) were investigated. The Boron subphthalocyanines BsubPcCl and BsubPcOH were synthesized. These derivatives were then used to prepare BsubPcSiHx3, BsubPcBu, and BsubPcOSi(CH2CH2CH2CH3)3. This study represents the first synthesis of axial substitution on boron subphthalocyanine with a tributylsiloxy group. The products were characterized by infrared spectroscopy, 1H nuclear magnetic resonance analysis, and high resolution mass spectroscopy.</p>","abstract_html":"&lt;p&gt;Part 1. The kinetics of the ligand exchange reaction between 5-methyl-1,10-phenanthroline and triethylenetetramine nickel (II) were studied spectrophotometrically over the pH range of 5.2 to 8.0 at 25oC. A ternary complex Ni(Trien)(5MP) forms within a few seconds and subsequently reacts with 5MP to form Ni(5MP)3. The reaction is first-order with respect to: [5MP], [Ni(Trien)(5MP)] and [H+]. The rate law is given by:&lt;/p&gt; &lt;p&gt;k dt d[Ni(trien)] = ( − MP Ni(trien)(5MP) + kH, 5MP Ni(trien)(5MP) [H+]) [Ni(trien)][5mp]&lt;/p&gt; &lt;p&gt;where: 5MP is 5-methyl-1,10-phenanthroline and k is the first order rate constant that has units of 1/time.&lt;/p&gt; &lt;p&gt;kH, 5mp Ni(trien)(5mp) = 9.78 X 104 M-2 s-1&lt;/p&gt; &lt;p&gt;and k5mp Ni(trien)(5mp) = 9.42 X 10-3 M-2 s-1&lt;/p&gt; &lt;p&gt;Part 2. Axial substitution on boron (III) subphthalocyanines (SubPcs) were investigated. The Boron subphthalocyanines BsubPcCl and BsubPcOH were synthesized. These derivatives were then used to prepare BsubPcSiHx3, BsubPcBu, and BsubPcOSi(CH2CH2CH2CH3)3. This study represents the first synthesis of axial substitution on boron subphthalocyanine with a tributylsiloxy group. The products were characterized by infrared spectroscopy, 1H nuclear magnetic resonance analysis, and high resolution mass spectroscopy.&lt;/p&gt;","abstract_has_math":false,"creators":["Cate, Michael Christopher"],"institution":null,"degree_name":"Master of Science (MS)","degree_level":"Open Access Thesis","degree_discipline":"Chemistry","degree_department":null,"school":null,"contributors":["Vance Kennedy, PhD, Chair","Timothy Brewer, PhD","Harriet Lindsay, PhD"],"advisors":[],"committee_chairs":[],"committee_members":[],"year":null,"date_issued":"","date_published":null,"updated_at":"2026-08-21T16:44:53Z","subjects":["Boron compounds","Hazardous wastes research","Nickel compounds","Chemistry"],"languages":[],"rights":[],"rights_urls":[],"identifier_entries":[]},"links":{"outbound_url":"https://commons.emich.edu/theses/43","outbound_label":"Repository record","outbound_source":"dc:identifier"},"source_record":{"url":"https://commons.emich.edu/do/oai/?verb=GetRecord&metadataPrefix=oai_etdms&identifier=oai%3Acommons.emich.edu%3Atheses-1042","prefix":"oai_etdms"},"metadata_groups":[{"id":"people","label":"People","entries":[{"key":"dc:contributor","label":"Contributor","values":["Vance Kennedy, PhD, Chair","Timothy Brewer, PhD","Harriet Lindsay, PhD"]},{"key":"dc:creator","label":"Author","values":["Cate, Michael Christopher"]}]},{"id":"academic_context","label":"Academic Context","entries":[{"key":"thesis:degree_discipline","label":"Discipline","values":["Chemistry"]},{"key":"thesis:degree_level","label":"Degree Level","values":["Open Access Thesis"]},{"key":"thesis:degree_name","label":"Degree Name","values":["Master of Science (MS)"]}]},{"id":"subjects_keywords","label":"Subjects and Keywords","entries":[{"key":"dc:subject","label":"Dc Subject","values":["Boron compounds","Hazardous wastes research","Nickel compounds","Chemistry"]}]},{"id":"identifiers","label":"Identifiers","entries":[{"key":"dc:identifier","label":"Identifier","values":["https://commons.emich.edu/theses/43"]}]},{"id":"additional","label":"Additional Metadata","entries":[{"key":"dc:description.abstract","label":"Abstract","values":["<p>Part 1. The kinetics of the ligand exchange reaction between 5-methyl-1,10-phenanthroline and triethylenetetramine nickel (II) were studied spectrophotometrically over the pH range of 5.2 to 8.0 at 25oC. A ternary complex Ni(Trien)(5MP) forms within a few seconds and subsequently reacts with 5MP to form Ni(5MP)3. The reaction is first-order with respect to: [5MP], [Ni(Trien)(5MP)] and [H+]. The rate law is given by:</p> <p>k dt d[Ni(trien)] = ( − MP Ni(trien)(5MP) + kH, 5MP Ni(trien)(5MP) [H+]) [Ni(trien)][5mp]</p> <p>where: 5MP is 5-methyl-1,10-phenanthroline and k is the first order rate constant that has units of 1/time.</p> <p>kH, 5mp Ni(trien)(5mp) = 9.78 X 104 M-2 s-1</p> <p>and k5mp Ni(trien)(5mp) = 9.42 X 10-3 M-2 s-1</p> <p>Part 2. Axial substitution on boron (III) subphthalocyanines (SubPcs) were investigated. The Boron subphthalocyanines BsubPcCl and BsubPcOH were synthesized. These derivatives were then used to prepare BsubPcSiHx3, BsubPcBu, and BsubPcOSi(CH2CH2CH2CH3)3. This study represents the first synthesis of axial substitution on boron subphthalocyanine with a tributylsiloxy group. The products were characterized by infrared spectroscopy, 1H nuclear magnetic resonance analysis, and high resolution mass spectroscopy.</p>"]},{"key":"dc:title","label":"Title","values":["Kinetics of the ligand exchange reactions between bidentate ligands and rriethylenetetramine nickelate (II) and synthesis of boron (III) subphthalocyanines with various boron substitutions"]}]}],"canonical_facts":{"dc:contributor":["Vance Kennedy, PhD, Chair","Timothy Brewer, PhD","Harriet Lindsay, PhD"],"dc:creator":["Cate, Michael Christopher"],"dc:description.abstract":["<p>Part 1. The kinetics of the ligand exchange reaction between 5-methyl-1,10-phenanthroline and triethylenetetramine nickel (II) were studied spectrophotometrically over the pH range of 5.2 to 8.0 at 25oC. A ternary complex Ni(Trien)(5MP) forms within a few seconds and subsequently reacts with 5MP to form Ni(5MP)3. The reaction is first-order with respect to: [5MP], [Ni(Trien)(5MP)] and [H+]. The rate law is given by:</p> <p>k dt d[Ni(trien)] = ( − MP Ni(trien)(5MP) + kH, 5MP Ni(trien)(5MP) [H+]) [Ni(trien)][5mp]</p> <p>where: 5MP is 5-methyl-1,10-phenanthroline and k is the first order rate constant that has units of 1/time.</p> <p>kH, 5mp Ni(trien)(5mp) = 9.78 X 104 M-2 s-1</p> <p>and k5mp Ni(trien)(5mp) = 9.42 X 10-3 M-2 s-1</p> <p>Part 2. Axial substitution on boron (III) subphthalocyanines (SubPcs) were investigated. The Boron subphthalocyanines BsubPcCl and BsubPcOH were synthesized. These derivatives were then used to prepare BsubPcSiHx3, BsubPcBu, and BsubPcOSi(CH2CH2CH2CH3)3. This study represents the first synthesis of axial substitution on boron subphthalocyanine with a tributylsiloxy group. The products were characterized by infrared spectroscopy, 1H nuclear magnetic resonance analysis, and high resolution mass spectroscopy.</p>"],"dc:identifier":["https://commons.emich.edu/theses/43"],"dc:subject":["Boron compounds","Hazardous wastes research","Nickel compounds","Chemistry"],"dc:title":["Kinetics of the ligand exchange reactions between bidentate ligands and rriethylenetetramine nickelate (II) and synthesis of boron (III) subphthalocyanines with various boron substitutions"],"thesis:degree_discipline":["Chemistry"],"thesis:degree_level":["Open Access Thesis"],"thesis:degree_name":["Master of Science (MS)"]},"updated_at":"2026-08-21T16:44:53Z"}